C33H30O7 — CID 163236581
2-(cyclohexanecarbonyl)-5-[2-(cyclohexanecarbonyl)-1,3-dioxoindene-5-carbonyl]indene-1,3-dione (PubChem CID 163236581) has the molecular formula C33H30O7 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyl)-5-[2-(cyclohexanecarbonyl)-1,3-dioxoindene-5-carbonyl]indene-1,3-dione.
| Compound Name | 2-(cyclohexanecarbonyl)-5-[2-(cyclohexanecarbonyl)-1,3-dioxoindene-5-carbonyl]indene-1,3-dione |
|---|---|
| PubChem CID | 163236581 |
| Molecular Formula | C33H30O7 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 2-(cyclohexanecarbonyl)-5-[2-(cyclohexanecarbonyl)-1,3-dioxoindene-5-carbonyl]indene-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)C(C(=O)C1CCCCC1)C2=O)c1ccc2c(c1)C(=O)C(C(=O)C1CCCCC1)C2=O |
| InChI | InChI=1S/C33H30O7/c34-27(19-11-13-21-23(15-19)32(39)25(30(21)37)28(35)17-7-3-1-4-8-17)20-12-14-22-24(16-20)33(40)26(31(22)38)29(36)18-9-5-2-6-10-18/h11-18,25-26H,1-10H2 |
| InChIKey | JQBILQXNRPRYNX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 119.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|