C34H40O8 — CID 163236815
bis(1-methoxypropane);5-(1-methylidene-3-oxo-2-propanoylindene-5-carbonyl)-2-propanoylindene-1,3-dione (PubChem CID 163236815) has the molecular formula C34H40O8 and a molecular weight of 576.69 g/mol. Its IUPAC name is bis(1-methoxypropane);5-(1-methylidene-3-oxo-2-propanoylindene-5-carbonyl)-2-propanoylindene-1,3-dione.
| Compound Name | bis(1-methoxypropane);5-(1-methylidene-3-oxo-2-propanoylindene-5-carbonyl)-2-propanoylindene-1,3-dione |
|---|---|
| PubChem CID | 163236815 |
| Molecular Formula | C34H40O8 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | bis(1-methoxypropane);5-(1-methylidene-3-oxo-2-propanoylindene-5-carbonyl)-2-propanoylindene-1,3-dione |
| SMILES | C=C1c2ccc(C(=O)c3ccc4c(c3)C(=O)C(C(=O)CC)C4=O)cc2C(=O)C1C(=O)CC.CCCOC.CCCOC |
| InChI | InChI=1S/C26H20O6.2C4H10O/c1-4-19(27)21-12(3)15-8-6-13(10-17(15)25(21)31)23(29)14-7-9-16-18(11-14)26(32)22(24(16)30)20(28)5-2;2*1-3-4-5-2/h6-11,21-22H,3-5H2,1-2H3;2*3-4H2,1-2H3 |
| InChIKey | JYZVXKGOXQLMJR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|