C28H28N2O8S — CID 163236725
N-cyclobutyl-5-[2-(cyclobutylcarbamoyl)-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide;molecular hydrogen (PubChem CID 163236725) has the molecular formula C28H28N2O8S and a molecular weight of 552.61 g/mol. Its IUPAC name is N-cyclobutyl-5-[2-(cyclobutylcarbamoyl)-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide;molecular hydrogen.
| Compound Name | N-cyclobutyl-5-[2-(cyclobutylcarbamoyl)-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 163236725 |
| Molecular Formula | C28H28N2O8S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | N-cyclobutyl-5-[2-(cyclobutylcarbamoyl)-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide;molecular hydrogen |
| SMILES | O=C(NC1CCC1)C1C(=O)c2ccc(S(=O)(=O)c3ccc4c(c3)C(=O)C(C(=O)NC3CCC3)C4=O)cc2C1=O.[H][H].[H][H] |
| InChI | InChI=1S/C28H24N2O8S.2H2/c31-23-17-9-7-15(11-19(17)25(33)21(23)27(35)29-13-3-1-4-13)39(37,38)16-8-10-18-20(12-16)26(34)22(24(18)32)28(36)30-14-5-2-6-14;;/h7-14,21-22H,1-6H2,(H,29,35)(H,30,36);2*1H |
| InChIKey | ACWWRILTXVBAFH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|