C20H22O8 — CID 139651437
2-(2,6-dimethoxyphenoxy)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 139651437) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 139651437 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C=C(Oc2c(OC)cccc2OC)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C20H22O8/c1-23-13-7-6-8-14(24-2)19(13)28-17(20(21)22)11-12-9-15(25-3)18(27-5)16(10-12)26-4/h6-11H,1-5H3,(H,21,22) |
| InChIKey | VCRKWJUJTGMGJW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|