C14H5F3O3S — CID 139657033
4,5,7-trifluoro-6-phenylsulfanyl-2-benzofuran-1,3-dione (PubChem CID 139657033) has the molecular formula C14H5F3O3S and a molecular weight of 310.25 g/mol. Its IUPAC name is 4,5,7-trifluoro-6-phenylsulfanyl-2-benzofuran-1,3-dione.
| Compound Name | 4,5,7-trifluoro-6-phenylsulfanyl-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 139657033 |
| Molecular Formula | C14H5F3O3S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 4,5,7-trifluoro-6-phenylsulfanyl-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c(F)c(Sc3ccccc3)c(F)c(F)c21 |
| InChI | InChI=1S/C14H5F3O3S/c15-9-7-8(14(19)20-13(7)18)10(16)12(11(9)17)21-6-4-2-1-3-5-6/h1-5H |
| InChIKey | CESMOUBSGZWRCM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|