C26H11F6NO2S — CID 139730396
1,4-difluoro-2-phenylsulfanyl-3-(2,3,5,6-tetrafluoroanilino)anthracene-9,10-dione (PubChem CID 139730396) has the molecular formula C26H11F6NO2S and a molecular weight of 515.43 g/mol. Its IUPAC name is 1,4-difluoro-2-phenylsulfanyl-3-(2,3,5,6-tetrafluoroanilino)anthracene-9,10-dione.
| Compound Name | 1,4-difluoro-2-phenylsulfanyl-3-(2,3,5,6-tetrafluoroanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 139730396 |
| Molecular Formula | C26H11F6NO2S |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | 1,4-difluoro-2-phenylsulfanyl-3-(2,3,5,6-tetrafluoroanilino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(F)c(Sc3ccccc3)c(Nc3c(F)c(F)cc(F)c3F)c(F)c21 |
| InChI | InChI=1S/C26H11F6NO2S/c27-14-10-15(28)19(30)22(18(14)29)33-23-20(31)16-17(21(32)26(23)36-11-6-2-1-3-7-11)25(35)13-9-5-4-8-12(13)24(16)34/h1-10,33H |
| InChIKey | ZDPZPHSNJOKDNJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|