C26H10Cl6F2N2O2 — CID 146457214
1,4-difluoro-2,3-bis(2,3,4-trichloroanilino)anthracene-9,10-dione (PubChem CID 146457214) has the molecular formula C26H10Cl6F2N2O2 and a molecular weight of 633.09 g/mol. Its IUPAC name is 1,4-difluoro-2,3-bis(2,3,4-trichloroanilino)anthracene-9,10-dione.
| Compound Name | 1,4-difluoro-2,3-bis(2,3,4-trichloroanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 146457214 |
| Molecular Formula | C26H10Cl6F2N2O2 |
| Molecular Weight | 633.09 g/mol |
| Exact Mass | 629.88 |
| IUPAC Name | 1,4-difluoro-2,3-bis(2,3,4-trichloroanilino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(F)c(Nc3ccc(Cl)c(Cl)c3Cl)c(Nc3ccc(Cl)c(Cl)c3Cl)c(F)c21 |
| InChI | InChI=1S/C26H10Cl6F2N2O2/c27-11-5-7-13(19(31)17(11)29)35-23-21(33)15-16(26(38)10-4-2-1-3-9(10)25(15)37)22(34)24(23)36-14-8-6-12(28)18(30)20(14)32/h1-8,35-36H |
| InChIKey | GBMIJSPTGXGHCO-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.09 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|