C24H44O2Si6 — CID 139660990
4-[(4-hydroxyphenyl)-(1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinan-1-yl)methyl]phenol (PubChem CID 139660990) has the molecular formula C24H44O2Si6 and a molecular weight of 533.13 g/mol. Its IUPAC name is 4-[(4-hydroxyphenyl)-(1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinan-1-yl)methyl]phenol.
| Compound Name | 4-[(4-hydroxyphenyl)-(1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinan-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 139660990 |
| Molecular Formula | C24H44O2Si6 |
| Molecular Weight | 533.13 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 4-[(4-hydroxyphenyl)-(1,2,2,3,3,4,4,5,5,6,6-undecamethylhexasilinan-1-yl)methyl]phenol |
| SMILES | C[Si]1(C)[Si](C)(C)[Si](C)(C)[Si](C)(C(c2ccc(O)cc2)c2ccc(O)cc2)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C24H44O2Si6/c1-27(2)28(3,4)30(7,8)32(11,31(9,10)29(27,5)6)24(20-12-16-22(25)17-13-20)21-14-18-23(26)19-15-21/h12-19,24-26H,1-11H3 |
| InChIKey | OPPNRCULCZQPCU-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.13 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|