C13H11F3O3S — CID 139662794
2-[2-(acetylsulfanylmethyl)-3-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 139662794) has the molecular formula C13H11F3O3S and a molecular weight of 304.29 g/mol. Its IUPAC name is 2-[2-(acetylsulfanylmethyl)-3-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | 2-[2-(acetylsulfanylmethyl)-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139662794 |
| Molecular Formula | C13H11F3O3S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[2-(acetylsulfanylmethyl)-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1cccc(C(F)(F)F)c1CSC(C)=O |
| InChI | InChI=1S/C13H11F3O3S/c1-7(12(18)19)9-4-3-5-11(13(14,15)16)10(9)6-20-8(2)17/h3-5H,1,6H2,2H3,(H,18,19) |
| InChIKey | CLZNSGXTNHRMBF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|