C14H16N2S3 — CID 139671633
5-[4-(3-ethenylphenyl)butylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 139671633) has the molecular formula C14H16N2S3 and a molecular weight of 308.50 g/mol. Its IUPAC name is 5-[4-(3-ethenylphenyl)butylsulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[4-(3-ethenylphenyl)butylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 139671633 |
| Molecular Formula | C14H16N2S3 |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 5-[4-(3-ethenylphenyl)butylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | C=Cc1cccc(CCCCSc2n[nH]c(=S)s2)c1 |
| InChI | InChI=1S/C14H16N2S3/c1-2-11-7-5-8-12(10-11)6-3-4-9-18-14-16-15-13(17)19-14/h2,5,7-8,10H,1,3-4,6,9H2,(H,15,17) |
| InChIKey | YPPQQCUFLKFNKS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|