C19H19N3O6S — CID 139675460
(4-nitrophenyl)methyl 2-[(2R,3R)-3-amino-1-(hydroxymethyl)-4-oxoazetidin-2-yl]sulfanyl-2-phenylacetate (PubChem CID 139675460) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R,3R)-3-amino-1-(hydroxymethyl)-4-oxoazetidin-2-yl]sulfanyl-2-phenylacetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R,3R)-3-amino-1-(hydroxymethyl)-4-oxoazetidin-2-yl]sulfanyl-2-phenylacetate |
|---|---|
| PubChem CID | 139675460 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R,3R)-3-amino-1-(hydroxymethyl)-4-oxoazetidin-2-yl]sulfanyl-2-phenylacetate |
| SMILES | N[C@@H]1C(=O)N(CO)[C@@H]1SC(C(=O)OCc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O6S/c20-15-17(24)21(11-23)18(15)29-16(13-4-2-1-3-5-13)19(25)28-10-12-6-8-14(9-7-12)22(26)27/h1-9,15-16,18,23H,10-11,20H2/t15-,16?,18-/m1/s1 |
| InChIKey | ILGCJEIONGOCQI-IFJNFQAOSA-N |
| XLogP | 1.56 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|