C23H22N6O6 — CID 139676453
ethyl 1-methyl-4-[[1-methyl-4-[(6-nitro-1H-indole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxylate (PubChem CID 139676453) has the molecular formula C23H22N6O6 and a molecular weight of 478.47 g/mol. Its IUPAC name is ethyl 1-methyl-4-[[1-methyl-4-[(6-nitro-1H-indole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-methyl-4-[[1-methyl-4-[(6-nitro-1H-indole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 139676453 |
| Molecular Formula | C23H22N6O6 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | ethyl 1-methyl-4-[[1-methyl-4-[(6-nitro-1H-indole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc4ccc([N+](=O)[O-])cc4[nH]3)cn2C)cn1C |
| InChI | InChI=1S/C23H22N6O6/c1-4-35-23(32)20-9-15(12-28(20)3)25-22(31)19-8-14(11-27(19)2)24-21(30)18-7-13-5-6-16(29(33)34)10-17(13)26-18/h5-12,26H,4H2,1-3H3,(H,24,30)(H,25,31) |
| InChIKey | QLRKWXIDCWWBCJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|