C8H8ClN3O2 — CID 139677932
4-amino-1H-quinoxaline-2,3-dione;hydrochloride (PubChem CID 139677932) has the molecular formula C8H8ClN3O2 and a molecular weight of 213.62 g/mol. Its IUPAC name is 4-amino-1H-quinoxaline-2,3-dione;hydrochloride.
| Compound Name | 4-amino-1H-quinoxaline-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 139677932 |
| Molecular Formula | C8H8ClN3O2 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 4-amino-1H-quinoxaline-2,3-dione;hydrochloride |
| SMILES | Cl.Nn1c(=O)c(=O)[nH]c2ccccc21 |
| InChI | InChI=1S/C8H7N3O2.ClH/c9-11-6-4-2-1-3-5(6)10-7(12)8(11)13;/h1-4H,9H2,(H,10,12);1H |
| InChIKey | KROQGTYKZNQPNC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|