C10H10N2O3S — CID 139685383
(2R,4R)-4-formyl-2-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 139685383) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is (2R,4R)-4-formyl-2-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-4-formyl-2-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 139685383 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | (2R,4R)-4-formyl-2-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C[C@@]1(C(=O)O)CS[C@H](c2cccnc2)N1 |
| InChI | InChI=1S/C10H10N2O3S/c13-5-10(9(14)15)6-16-8(12-10)7-2-1-3-11-4-7/h1-5,8,12H,6H2,(H,14,15)/t8-,10+/m1/s1 |
| InChIKey | SAWULTQOZNVDAZ-SCZZXKLOSA-N |
| XLogP | 0.44 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|