methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate

C15H17NO2S — CID 139686137

IUPACmethyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate
SMILESCOC(=O)CN1CSC(=CC=Cc2ccccc2)C1
InChIInChI=1S/C15H17NO2S/c1-18-15(17)11-16-10-14(19-12-16)9-5-8-13-6-3-2-4-7-13/h2-9H,10-12H2,1H3
InChIKeyZMHHOTATJVGRCG-UHFFFAOYSA-N
MW275.37 g/mol
LogP2.76
Rot. Bonds4

About methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate

methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate (PubChem CID 139686137) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate
PubChem CID139686137
Molecular FormulaC15H17NO2S
Molecular Weight275.37 g/mol
Exact Mass275.10
IUPAC Namemethyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate
SMILESCOC(=O)CN1CSC(=CC=Cc2ccccc2)C1
InChIInChI=1S/C15H17NO2S/c1-18-15(17)11-16-10-14(19-12-16)9-5-8-13-6-3-2-4-7-13/h2-9H,10-12H2,1H3
InChIKeyZMHHOTATJVGRCG-UHFFFAOYSA-N
XLogP2.76
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.37
LogP ≤ 52.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate?
The IUPAC name of methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate (CID 139686137) is methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate.
What is the SMILES notation for methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate?
The canonical SMILES for methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate is COC(=O)CN1CSC(=CC=Cc2ccccc2)C1.
What is the InChIKey of methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate?
The InChIKey is ZMHHOTATJVGRCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2S/c1-18-15(17)11-16-10-14(19-12-16)9-5-8-13-6-3-2-4-7-13/h2-9H,10-12H2,1H3.
What are the key properties of methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate?
methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate has a molecular weight of 275.37 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-cinnamylidene-1,3-thiazolidin-3-yl)acetate is sourced from PubChem (CID 139686137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).