C17H20O4 — CID 146653275
methyl 3-oxo-5-[(2E,4E)-5-phenylpenta-2,4-dienoxy]pentanoate (PubChem CID 146653275) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is methyl 3-oxo-5-[(2E,4E)-5-phenylpenta-2,4-dienoxy]pentanoate.
| Compound Name | methyl 3-oxo-5-[(2E,4E)-5-phenylpenta-2,4-dienoxy]pentanoate |
|---|---|
| PubChem CID | 146653275 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | methyl 3-oxo-5-[(2E,4E)-5-phenylpenta-2,4-dienoxy]pentanoate |
| SMILES | COC(=O)CC(=O)CCOC/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H20O4/c1-20-17(19)14-16(18)11-13-21-12-7-3-6-10-15-8-4-2-5-9-15/h2-10H,11-14H2,1H3/b7-3+,10-6+ |
| InChIKey | YUGZJTSHXHSECS-ASVGJQBISA-N |
| XLogP | 2.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|