C28H26N2O3S2 — CID 139688396
3-(2-nitrophenyl)-N-propyl-N-[[3-[(4-thiophen-3-ylthiophen-2-yl)methoxy]phenyl]methyl]prop-2-yn-1-amine (PubChem CID 139688396) has the molecular formula C28H26N2O3S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-N-propyl-N-[[3-[(4-thiophen-3-ylthiophen-2-yl)methoxy]phenyl]methyl]prop-2-yn-1-amine.
| Compound Name | 3-(2-nitrophenyl)-N-propyl-N-[[3-[(4-thiophen-3-ylthiophen-2-yl)methoxy]phenyl]methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 139688396 |
| Molecular Formula | C28H26N2O3S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 3-(2-nitrophenyl)-N-propyl-N-[[3-[(4-thiophen-3-ylthiophen-2-yl)methoxy]phenyl]methyl]prop-2-yn-1-amine |
| SMILES | CCCN(CC#Cc1ccccc1[N+](=O)[O-])Cc1cccc(OCc2cc(-c3ccsc3)cs2)c1 |
| InChI | InChI=1S/C28H26N2O3S2/c1-2-13-29(14-6-9-23-8-3-4-11-28(23)30(31)32)18-22-7-5-10-26(16-22)33-19-27-17-25(21-35-27)24-12-15-34-20-24/h3-5,7-8,10-12,15-17,20-21H,2,13-14,18-19H2,1H3 |
| InChIKey | NFYSYUBYRFPPKZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|