C25H31NO2S — CID 19917144
N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylphenoxy)ethoxy]ethyl]hepta-2,4-diyn-1-amine (PubChem CID 19917144) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylphenoxy)ethoxy]ethyl]hepta-2,4-diyn-1-amine.
| Compound Name | N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylphenoxy)ethoxy]ethyl]hepta-2,4-diyn-1-amine |
|---|---|
| PubChem CID | 19917144 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylphenoxy)ethoxy]ethyl]hepta-2,4-diyn-1-amine |
| SMILES | CCN(CC#CC#CC(C)(C)C)CCOCCOc1cccc(-c2ccsc2)c1 |
| InChI | InChI=1S/C25H31NO2S/c1-5-26(14-8-6-7-13-25(2,3)4)15-16-27-17-18-28-24-11-9-10-22(20-24)23-12-19-29-21-23/h9-12,19-21H,5,14-18H2,1-4H3 |
| InChIKey | PLTGFOLXABEJNS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|