C27H34OS — CID 19390177
3-[3-[(5Z,8E)-6-ethyl-12,12-dimethyltrideca-5,8-dien-10-ynoxy]phenyl]thiophene (PubChem CID 19390177) has the molecular formula C27H34OS and a molecular weight of 406.64 g/mol. Its IUPAC name is 3-[3-[(5Z,8E)-6-ethyl-12,12-dimethyltrideca-5,8-dien-10-ynoxy]phenyl]thiophene.
| Compound Name | 3-[3-[(5Z,8E)-6-ethyl-12,12-dimethyltrideca-5,8-dien-10-ynoxy]phenyl]thiophene |
|---|---|
| PubChem CID | 19390177 |
| Molecular Formula | C27H34OS |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 3-[3-[(5Z,8E)-6-ethyl-12,12-dimethyltrideca-5,8-dien-10-ynoxy]phenyl]thiophene |
| SMILES | CC/C(=C/CCCCOc1cccc(-c2ccsc2)c1)C/C=C/C#CC(C)(C)C |
| InChI | InChI=1S/C27H34OS/c1-5-23(13-8-6-10-18-27(2,3)4)14-9-7-11-19-28-26-16-12-15-24(21-26)25-17-20-29-22-25/h6,8,12,14-17,20-22H,5,7,9,11,13,19H2,1-4H3/b8-6+,23-14- |
| InChIKey | KCUPVJFPKAVVDI-HWTQHHHFSA-N |
| XLogP | 8.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|