C28H34O3S — CID 22069773
[(E,2E)-8,8-dimethyl-2-[5-(3-thiophen-3-ylphenoxy)pentylidene]non-4-en-6-ynyl] acetate (PubChem CID 22069773) has the molecular formula C28H34O3S and a molecular weight of 450.64 g/mol. Its IUPAC name is [(E,2E)-8,8-dimethyl-2-[5-(3-thiophen-3-ylphenoxy)pentylidene]non-4-en-6-ynyl] acetate.
| Compound Name | [(E,2E)-8,8-dimethyl-2-[5-(3-thiophen-3-ylphenoxy)pentylidene]non-4-en-6-ynyl] acetate |
|---|---|
| PubChem CID | 22069773 |
| Molecular Formula | C28H34O3S |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [(E,2E)-8,8-dimethyl-2-[5-(3-thiophen-3-ylphenoxy)pentylidene]non-4-en-6-ynyl] acetate |
| SMILES | CC(=O)OC/C(=C/CCCCOc1cccc(-c2ccsc2)c1)C/C=C/C#CC(C)(C)C |
| InChI | InChI=1S/C28H34O3S/c1-23(29)31-21-24(12-7-5-9-17-28(2,3)4)13-8-6-10-18-30-27-15-11-14-25(20-27)26-16-19-32-22-26/h5,7,11,13-16,19-20,22H,6,8,10,12,18,21H2,1-4H3/b7-5+,24-13+ |
| InChIKey | IALGQBLCZJIUNQ-GHRZAKMRSA-N |
| XLogP | 7.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|