C29H32O2S — CID 54036348
8,8-dimethyl-2-[[3-[(3-thiophen-3-ylphenyl)methoxy]phenyl]methyl]non-4-en-6-yn-1-ol (PubChem CID 54036348) has the molecular formula C29H32O2S and a molecular weight of 444.64 g/mol. Its IUPAC name is 8,8-dimethyl-2-[[3-[(3-thiophen-3-ylphenyl)methoxy]phenyl]methyl]non-4-en-6-yn-1-ol.
| Compound Name | 8,8-dimethyl-2-[[3-[(3-thiophen-3-ylphenyl)methoxy]phenyl]methyl]non-4-en-6-yn-1-ol |
|---|---|
| PubChem CID | 54036348 |
| Molecular Formula | C29H32O2S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 8,8-dimethyl-2-[[3-[(3-thiophen-3-ylphenyl)methoxy]phenyl]methyl]non-4-en-6-yn-1-ol |
| SMILES | CC(C)(C)C#CC=CCC(CO)Cc1cccc(OCc2cccc(-c3ccsc3)c2)c1 |
| InChI | InChI=1S/C29H32O2S/c1-29(2,3)15-6-4-5-9-24(20-30)17-23-10-8-13-28(19-23)31-21-25-11-7-12-26(18-25)27-14-16-32-22-27/h4-5,7-8,10-14,16,18-19,22,24,30H,9,17,20-21H2,1-3H3 |
| InChIKey | LJFVGUNECKUUSV-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|