C26H34O2S — CID 54362824
6,12,12-trimethyl-1-(3-thiophen-3-ylphenoxy)tridec-8-en-10-yn-5-ol (PubChem CID 54362824) has the molecular formula C26H34O2S and a molecular weight of 410.62 g/mol. Its IUPAC name is 6,12,12-trimethyl-1-(3-thiophen-3-ylphenoxy)tridec-8-en-10-yn-5-ol.
| Compound Name | 6,12,12-trimethyl-1-(3-thiophen-3-ylphenoxy)tridec-8-en-10-yn-5-ol |
|---|---|
| PubChem CID | 54362824 |
| Molecular Formula | C26H34O2S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 6,12,12-trimethyl-1-(3-thiophen-3-ylphenoxy)tridec-8-en-10-yn-5-ol |
| SMILES | CC(CC=CC#CC(C)(C)C)C(O)CCCCOc1cccc(-c2ccsc2)c1 |
| InChI | InChI=1S/C26H34O2S/c1-21(11-6-5-8-16-26(2,3)4)25(27)14-7-9-17-28-24-13-10-12-22(19-24)23-15-18-29-20-23/h5-6,10,12-13,15,18-21,25,27H,7,9,11,14,17H2,1-4H3 |
| InChIKey | UNRXCIOGCKTYOD-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|