C26H35NO2S — CID 54281296
N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylphenoxy)ethoxy]ethyl]oct-2-en-4-yn-1-amine (PubChem CID 54281296) has the molecular formula C26H35NO2S and a molecular weight of 425.64 g/mol. Its IUPAC name is N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylphenoxy)ethoxy]ethyl]oct-2-en-4-yn-1-amine.
| Compound Name | N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylphenoxy)ethoxy]ethyl]oct-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 54281296 |
| Molecular Formula | C26H35NO2S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylphenoxy)ethoxy]ethyl]oct-2-en-4-yn-1-amine |
| SMILES | CCN(CC=CC#CC(C)(C)CC)CCOCCOc1cccc(-c2ccsc2)c1 |
| InChI | InChI=1S/C26H35NO2S/c1-5-26(3,4)14-8-7-9-15-27(6-2)16-17-28-18-19-29-25-12-10-11-23(21-25)24-13-20-30-22-24/h7,9-13,20-22H,5-6,15-19H2,1-4H3 |
| InChIKey | RQYQAQGYRZDVLX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|