C28H34O3S — CID 57306247
methyl 2-[1-hydroxy-6-(3-thiophen-3-ylphenyl)hex-5-enyl]-8,8-dimethylnon-4-en-6-ynoate (PubChem CID 57306247) has the molecular formula C28H34O3S and a molecular weight of 450.64 g/mol. Its IUPAC name is methyl 2-[1-hydroxy-6-(3-thiophen-3-ylphenyl)hex-5-enyl]-8,8-dimethylnon-4-en-6-ynoate.
| Compound Name | methyl 2-[1-hydroxy-6-(3-thiophen-3-ylphenyl)hex-5-enyl]-8,8-dimethylnon-4-en-6-ynoate |
|---|---|
| PubChem CID | 57306247 |
| Molecular Formula | C28H34O3S |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | methyl 2-[1-hydroxy-6-(3-thiophen-3-ylphenyl)hex-5-enyl]-8,8-dimethylnon-4-en-6-ynoate |
| SMILES | COC(=O)C(CC=CC#CC(C)(C)C)C(O)CCCC=Cc1cccc(-c2ccsc2)c1 |
| InChI | InChI=1S/C28H34O3S/c1-28(2,3)18-10-6-8-15-25(27(30)31-4)26(29)16-9-5-7-12-22-13-11-14-23(20-22)24-17-19-32-21-24/h6-8,11-14,17,19-21,25-26,29H,5,9,15-16H2,1-4H3 |
| InChIKey | QNVRRQVGRHFDAV-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|