C27H33NO2S — CID 19917138
(E)-6-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]-1-hydroxy-1-(3-thiophen-3-ylphenyl)hex-5-en-3-one (PubChem CID 19917138) has the molecular formula C27H33NO2S and a molecular weight of 435.63 g/mol. Its IUPAC name is (E)-6-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]-1-hydroxy-1-(3-thiophen-3-ylphenyl)hex-5-en-3-one.
| Compound Name | (E)-6-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]-1-hydroxy-1-(3-thiophen-3-ylphenyl)hex-5-en-3-one |
|---|---|
| PubChem CID | 19917138 |
| Molecular Formula | C27H33NO2S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (E)-6-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]-1-hydroxy-1-(3-thiophen-3-ylphenyl)hex-5-en-3-one |
| SMILES | CCN(/C=C/CC(=O)CC(O)c1cccc(-c2ccsc2)c1)C/C=C/C#CC(C)(C)C |
| InChI | InChI=1S/C27H33NO2S/c1-5-28(16-8-6-7-15-27(2,3)4)17-10-13-25(29)20-26(30)23-12-9-11-22(19-23)24-14-18-31-21-24/h6,8-12,14,17-19,21,26,30H,5,13,16,20H2,1-4H3/b8-6+,17-10+ |
| InChIKey | XNOPFPMJWUNBOX-FVKMJGKXSA-N |
| XLogP | 6.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|