About 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene
3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene (PubChem CID 54294370) has the molecular formula C30H30OS
and a molecular weight of 438.64 g/mol. Its IUPAC name is 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene.
Molecular Properties
| Compound Name | 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene |
| PubChem CID | 54294370 |
| Molecular Formula | C30H30OS |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene |
| SMILES | COC(C)(C)C#CC=CCC(C)=Cc1cccc(C=Cc2cccc(-c3ccsc3)c2)c1 |
| InChI | InChI=1S/C30H30OS/c1-24(10-6-5-7-18-30(2,3)31-4)20-27-13-8-11-25(21-27)15-16-26-12-9-14-28(22-26)29-17-19-32-23-29/h5-6,8-9,11-17,19-23H,10H2,1-4H3 |
| InChIKey | RZTMSTVRWIHJCH-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene?
The IUPAC name of 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene (CID 54294370) is 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene.
What is the SMILES notation for 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene?
The canonical SMILES for 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene is COC(C)(C)C#CC=CCC(C)=Cc1cccc(C=Cc2cccc(-c3ccsc3)c2)c1.
What is the InChIKey of 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene?
The InChIKey is RZTMSTVRWIHJCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30OS/c1-24(10-6-5-7-18-30(2,3)31-4)20-27-13-8-11-25(21-27)15-16-26-12-9-14-28(22-26)29-17-19-32-23-29/h5-6,8-9,11-17,19-23H,10H2,1-4H3.
What are the key properties of 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene?
3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene has a molecular weight of 438.64 g/mol, XLogP of 8.36, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[2-[3-(8-methoxy-2,8-dimethylnona-1,4-dien-6-ynyl)phenyl]ethenyl]phenyl]thiophene is sourced from PubChem (CID 54294370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).