C19H20O3S — CID 67787886
methyl (E)-3-oxo-8-(3-thiophen-3-ylphenyl)oct-7-enoate (PubChem CID 67787886) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is methyl (E)-3-oxo-8-(3-thiophen-3-ylphenyl)oct-7-enoate.
| Compound Name | methyl (E)-3-oxo-8-(3-thiophen-3-ylphenyl)oct-7-enoate |
|---|---|
| PubChem CID | 67787886 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl (E)-3-oxo-8-(3-thiophen-3-ylphenyl)oct-7-enoate |
| SMILES | COC(=O)CC(=O)CCC/C=C/c1cccc(-c2ccsc2)c1 |
| InChI | InChI=1S/C19H20O3S/c1-22-19(21)13-18(20)9-4-2-3-6-15-7-5-8-16(12-15)17-10-11-23-14-17/h3,5-8,10-12,14H,2,4,9,13H2,1H3/b6-3+ |
| InChIKey | AAOCPSACSFFCBY-ZZXKWVIFSA-N |
| XLogP | 4.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|