C14H19F2NO2S — CID 139689648
2-methylpropyl 2-(5-amino-2,4-difluorophenyl)sulfanylbutanoate (PubChem CID 139689648) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-methylpropyl 2-(5-amino-2,4-difluorophenyl)sulfanylbutanoate.
| Compound Name | 2-methylpropyl 2-(5-amino-2,4-difluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 139689648 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-methylpropyl 2-(5-amino-2,4-difluorophenyl)sulfanylbutanoate |
| SMILES | CCC(Sc1cc(N)c(F)cc1F)C(=O)OCC(C)C |
| InChI | InChI=1S/C14H19F2NO2S/c1-4-12(14(18)19-7-8(2)3)20-13-6-11(17)9(15)5-10(13)16/h5-6,8,12H,4,7,17H2,1-3H3 |
| InChIKey | IEGDPUHDHRXVCN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|