C18H16ClN3O5S2 — CID 139690525
2-[N-(4-chlorophenyl)sulfonyl-4-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]anilino]acetic acid (PubChem CID 139690525) has the molecular formula C18H16ClN3O5S2 and a molecular weight of 453.93 g/mol. Its IUPAC name is 2-[N-(4-chlorophenyl)sulfonyl-4-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]anilino]acetic acid.
| Compound Name | 2-[N-(4-chlorophenyl)sulfonyl-4-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]anilino]acetic acid |
|---|---|
| PubChem CID | 139690525 |
| Molecular Formula | C18H16ClN3O5S2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | 2-[N-(4-chlorophenyl)sulfonyl-4-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]anilino]acetic acid |
| SMILES | [H]/N=C1\NC(=O)C(Cc2ccc(N(CC(=O)O)S(=O)(=O)c3ccc(Cl)cc3)cc2)S1 |
| InChI | InChI=1S/C18H16ClN3O5S2/c19-12-3-7-14(8-4-12)29(26,27)22(10-16(23)24)13-5-1-11(2-6-13)9-15-17(25)21-18(20)28-15/h1-8,15H,9-10H2,(H,23,24)(H2,20,21,25) |
| InChIKey | PDNPFOAPSHXIFI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|