C16H34O2 — CID 139690871
2,2,6-trimethyl-3,3-di(propan-2-yloxy)heptane (PubChem CID 139690871) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 2,2,6-trimethyl-3,3-di(propan-2-yloxy)heptane.
| Compound Name | 2,2,6-trimethyl-3,3-di(propan-2-yloxy)heptane |
|---|---|
| PubChem CID | 139690871 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 2,2,6-trimethyl-3,3-di(propan-2-yloxy)heptane |
| SMILES | CC(C)CCC(OC(C)C)(OC(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H34O2/c1-12(2)10-11-16(15(7,8)9,17-13(3)4)18-14(5)6/h12-14H,10-11H2,1-9H3 |
| InChIKey | ATTAEKRPACGESX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|