C17H34N2O4 — CID 139696676
N-[(2S)-3-hydroxy-1-(methoxymethylamino)-1-oxopropan-2-yl]dodecanamide (PubChem CID 139696676) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-[(2S)-3-hydroxy-1-(methoxymethylamino)-1-oxopropan-2-yl]dodecanamide.
| Compound Name | N-[(2S)-3-hydroxy-1-(methoxymethylamino)-1-oxopropan-2-yl]dodecanamide |
|---|---|
| PubChem CID | 139696676 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | N-[(2S)-3-hydroxy-1-(methoxymethylamino)-1-oxopropan-2-yl]dodecanamide |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CO)C(=O)NCOC |
| InChI | InChI=1S/C17H34N2O4/c1-3-4-5-6-7-8-9-10-11-12-16(21)19-15(13-20)17(22)18-14-23-2/h15,20H,3-14H2,1-2H3,(H,18,22)(H,19,21)/t15-/m0/s1 |
| InChIKey | WQEBMYDTUJIOTR-HNNXBMFYSA-N |
| XLogP | 2.10 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|