C3H10N2O5 — CID 139697819
1,3-bis(dihydroxyamino)propan-2-ol (PubChem CID 139697819) has the molecular formula C3H10N2O5 and a molecular weight of 154.12 g/mol. Its IUPAC name is 1,3-bis(dihydroxyamino)propan-2-ol.
| Compound Name | 1,3-bis(dihydroxyamino)propan-2-ol |
|---|---|
| PubChem CID | 139697819 |
| Molecular Formula | C3H10N2O5 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1,3-bis(dihydroxyamino)propan-2-ol |
| SMILES | OC(CN(O)O)CN(O)O |
| InChI | InChI=1S/C3H10N2O5/c6-3(1-4(7)8)2-5(9)10/h3,6-10H,1-2H2 |
| InChIKey | ZKKOCXKWFFMZGJ-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|