C16H24O3 — CID 139705017
2-pentyl-4-propyl-2,3-dihydro-1-benzofuran-5,7-diol (PubChem CID 139705017) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-pentyl-4-propyl-2,3-dihydro-1-benzofuran-5,7-diol.
| Compound Name | 2-pentyl-4-propyl-2,3-dihydro-1-benzofuran-5,7-diol |
|---|---|
| PubChem CID | 139705017 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-pentyl-4-propyl-2,3-dihydro-1-benzofuran-5,7-diol |
| SMILES | CCCCCC1Cc2c(CCC)c(O)cc(O)c2O1 |
| InChI | InChI=1S/C16H24O3/c1-3-5-6-8-11-9-13-12(7-4-2)14(17)10-15(18)16(13)19-11/h10-11,17-18H,3-9H2,1-2H3 |
| InChIKey | BQIZCIUPRBUPED-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|