C18H24O4 — CID 163086072
(3R)-5-butyl-6,8-dihydroxy-3-pent-3-enyl-3,4-dihydroisochromen-1-one (PubChem CID 163086072) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (3R)-5-butyl-6,8-dihydroxy-3-pent-3-enyl-3,4-dihydroisochromen-1-one.
| Compound Name | (3R)-5-butyl-6,8-dihydroxy-3-pent-3-enyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 163086072 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (3R)-5-butyl-6,8-dihydroxy-3-pent-3-enyl-3,4-dihydroisochromen-1-one |
| SMILES | CC=CCC[C@@H]1Cc2c(CCCC)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H24O4/c1-3-5-7-8-12-10-14-13(9-6-4-2)15(19)11-16(20)17(14)18(21)22-12/h3,5,11-12,19-20H,4,6-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | SGAUHXBNICHBCR-GFCCVEGCSA-N |
| XLogP | 3.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|