C21H44O7 — CID 139705617
1,3-di(butan-2-yloxy)-1,3-bis(3-hydroxybutan-2-yloxy)-2,2-dimethylpropan-1-ol (PubChem CID 139705617) has the molecular formula C21H44O7 and a molecular weight of 408.58 g/mol. Its IUPAC name is 1,3-di(butan-2-yloxy)-1,3-bis(3-hydroxybutan-2-yloxy)-2,2-dimethylpropan-1-ol.
| Compound Name | 1,3-di(butan-2-yloxy)-1,3-bis(3-hydroxybutan-2-yloxy)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 139705617 |
| Molecular Formula | C21H44O7 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 1,3-di(butan-2-yloxy)-1,3-bis(3-hydroxybutan-2-yloxy)-2,2-dimethylpropan-1-ol |
| SMILES | CCC(C)OC(OC(C)C(C)O)C(C)(C)C(O)(OC(C)CC)OC(C)C(C)O |
| InChI | InChI=1S/C21H44O7/c1-11-13(3)25-19(26-17(7)15(5)22)20(9,10)21(24,27-14(4)12-2)28-18(8)16(6)23/h13-19,22-24H,11-12H2,1-10H3 |
| InChIKey | KYYSEIWOERHADS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|