About 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol
1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol (PubChem CID 144754993) has the molecular formula C8H18O4
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol.
Molecular Properties
| Compound Name | 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol |
| PubChem CID | 144754993 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol |
| SMILES | CC[C@H](C)OC(O)C(OC)OC |
| InChI | InChI=1S/C8H18O4/c1-5-6(2)12-7(9)8(10-3)11-4/h6-9H,5H2,1-4H3/t6-,7?/m0/s1 |
| InChIKey | ZYMOSBBUKUNLFG-PKPIPKONSA-N |
| XLogP | 0.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol?
The IUPAC name of 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol (CID 144754993) is 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol.
What is the SMILES notation for 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol?
The canonical SMILES for 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol is CC[C@H](C)OC(O)C(OC)OC.
What is the InChIKey of 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol?
The InChIKey is ZYMOSBBUKUNLFG-PKPIPKONSA-N. The full InChI is InChI=1S/C8H18O4/c1-5-6(2)12-7(9)8(10-3)11-4/h6-9H,5H2,1-4H3/t6-,7?/m0/s1.
What are the key properties of 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol?
1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol has a molecular weight of 178.23 g/mol, XLogP of 0.74, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-butan-2-yl]oxy-2,2-dimethoxyethanol is sourced from PubChem (CID 144754993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).