C12H6Cl8O4 — CID 139714569
bis(1,1,2,2-tetrachloroethyl) benzene-1,2-dicarboxylate (PubChem CID 139714569) has the molecular formula C12H6Cl8O4 and a molecular weight of 497.80 g/mol. Its IUPAC name is bis(1,1,2,2-tetrachloroethyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(1,1,2,2-tetrachloroethyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139714569 |
| Molecular Formula | C12H6Cl8O4 |
| Molecular Weight | 497.80 g/mol |
| Exact Mass | 493.78 |
| IUPAC Name | bis(1,1,2,2-tetrachloroethyl) benzene-1,2-dicarboxylate |
| SMILES | O=C(OC(Cl)(Cl)C(Cl)Cl)c1ccccc1C(=O)OC(Cl)(Cl)C(Cl)Cl |
| InChI | InChI=1S/C12H6Cl8O4/c13-9(14)11(17,18)23-7(21)5-3-1-2-4-6(5)8(22)24-12(19,20)10(15)16/h1-4,9-10H |
| InChIKey | XIXPCCMIHKSECS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.80 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|