C18H22O8 — CID 139747264
tetramethyl 2-ethenyl-1,2,3,6-tetrahydropentalene-1,3a,4,6a-tetracarboxylate (PubChem CID 139747264) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is tetramethyl 2-ethenyl-1,2,3,6-tetrahydropentalene-1,3a,4,6a-tetracarboxylate.
| Compound Name | tetramethyl 2-ethenyl-1,2,3,6-tetrahydropentalene-1,3a,4,6a-tetracarboxylate |
|---|---|
| PubChem CID | 139747264 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | tetramethyl 2-ethenyl-1,2,3,6-tetrahydropentalene-1,3a,4,6a-tetracarboxylate |
| SMILES | C=CC1CC2(C(=O)OC)C(C(=O)OC)=CCC2(C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C18H22O8/c1-6-10-9-18(16(22)26-5)11(13(19)23-2)7-8-17(18,15(21)25-4)12(10)14(20)24-3/h6-7,10,12H,1,8-9H2,2-5H3 |
| InChIKey | FLXHGBJACZXRRN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|