About trimethoxymethyl 4-hydroxy-2-methylidenebutanoate
trimethoxymethyl 4-hydroxy-2-methylidenebutanoate (PubChem CID 139754318) has the molecular formula C9H16O6
and a molecular weight of 220.22 g/mol. Its IUPAC name is trimethoxymethyl 4-hydroxy-2-methylidenebutanoate.
Molecular Properties
| Compound Name | trimethoxymethyl 4-hydroxy-2-methylidenebutanoate |
| PubChem CID | 139754318 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | trimethoxymethyl 4-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(CCO)C(=O)OC(OC)(OC)OC |
| InChI | InChI=1S/C9H16O6/c1-7(5-6-10)8(11)15-9(12-2,13-3)14-4/h10H,1,5-6H2,2-4H3 |
| InChIKey | WLMONVQIVQIFTA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze trimethoxymethyl 4-hydroxy-2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxymethyl 4-hydroxy-2-methylidenebutanoate?
The IUPAC name of trimethoxymethyl 4-hydroxy-2-methylidenebutanoate (CID 139754318) is trimethoxymethyl 4-hydroxy-2-methylidenebutanoate.
What is the SMILES notation for trimethoxymethyl 4-hydroxy-2-methylidenebutanoate?
The canonical SMILES for trimethoxymethyl 4-hydroxy-2-methylidenebutanoate is C=C(CCO)C(=O)OC(OC)(OC)OC.
What is the InChIKey of trimethoxymethyl 4-hydroxy-2-methylidenebutanoate?
The InChIKey is WLMONVQIVQIFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O6/c1-7(5-6-10)8(11)15-9(12-2,13-3)14-4/h10H,1,5-6H2,2-4H3.
What are the key properties of trimethoxymethyl 4-hydroxy-2-methylidenebutanoate?
trimethoxymethyl 4-hydroxy-2-methylidenebutanoate has a molecular weight of 220.22 g/mol, XLogP of 0.02, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxymethyl 4-hydroxy-2-methylidenebutanoate is sourced from PubChem (CID 139754318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).