C15H21ClF3NO3S — CID 139756435
2-(chloromethyl)-3-methyl-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]pyridine (PubChem CID 139756435) has the molecular formula C15H21ClF3NO3S and a molecular weight of 387.85 g/mol. Its IUPAC name is 2-(chloromethyl)-3-methyl-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]pyridine.
| Compound Name | 2-(chloromethyl)-3-methyl-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]pyridine |
|---|---|
| PubChem CID | 139756435 |
| Molecular Formula | C15H21ClF3NO3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-(chloromethyl)-3-methyl-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]pyridine |
| SMILES | Cc1c(SCCOCCOCCOCC(F)(F)F)ccnc1CCl |
| InChI | InChI=1S/C15H21ClF3NO3S/c1-12-13(10-16)20-3-2-14(12)24-9-8-22-5-4-21-6-7-23-11-15(17,18)19/h2-3H,4-11H2,1H3 |
| InChIKey | YDEYPNGMKUZVGU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|