C12H15ClF3NO3S — CID 139756509
3-chloro-2-methyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium (PubChem CID 139756509) has the molecular formula C12H15ClF3NO3S and a molecular weight of 345.77 g/mol. Its IUPAC name is 3-chloro-2-methyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium.
| Compound Name | 3-chloro-2-methyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium |
|---|---|
| PubChem CID | 139756509 |
| Molecular Formula | C12H15ClF3NO3S |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-chloro-2-methyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium |
| SMILES | Cc1c(Cl)c(SCCOCCOCC(F)(F)F)cc[n+]1[O-] |
| InChI | InChI=1S/C12H15ClF3NO3S/c1-9-11(13)10(2-3-17(9)18)21-7-6-19-4-5-20-8-12(14,15)16/h2-3H,4-8H2,1H3 |
| InChIKey | CUYWUUBVFKNBAT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|