C30H33N3O3S — CID 139757044
methyl 2-[(3-methylphenyl)methyl]-3-oxo-4-[2-(4-phenylpiperazin-1-yl)ethyl]-1,4-benzothiazine-2-carboxylate (PubChem CID 139757044) has the molecular formula C30H33N3O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is methyl 2-[(3-methylphenyl)methyl]-3-oxo-4-[2-(4-phenylpiperazin-1-yl)ethyl]-1,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 2-[(3-methylphenyl)methyl]-3-oxo-4-[2-(4-phenylpiperazin-1-yl)ethyl]-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 139757044 |
| Molecular Formula | C30H33N3O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | methyl 2-[(3-methylphenyl)methyl]-3-oxo-4-[2-(4-phenylpiperazin-1-yl)ethyl]-1,4-benzothiazine-2-carboxylate |
| SMILES | COC(=O)C1(Cc2cccc(C)c2)Sc2ccccc2N(CCN2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C30H33N3O3S/c1-23-9-8-10-24(21-23)22-30(29(35)36-2)28(34)33(26-13-6-7-14-27(26)37-30)20-17-31-15-18-32(19-16-31)25-11-4-3-5-12-25/h3-14,21H,15-20,22H2,1-2H3 |
| InChIKey | SPXSVISYLPPPHA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|