About methyl(dioctyl)sulfanium tetrafluoroborate
methyl(dioctyl)sulfanium tetrafluoroborate (PubChem CID 139757759) has the molecular formula C17H37BF4S
and a molecular weight of 360.35 g/mol. Its IUPAC name is methyl(dioctyl)sulfanium tetrafluoroborate.
Molecular Properties
| Compound Name | methyl(dioctyl)sulfanium tetrafluoroborate |
| PubChem CID | 139757759 |
| Molecular Formula | C17H37BF4S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | methyl(dioctyl)sulfanium tetrafluoroborate |
| SMILES | CCCCCCCC[S+](C)CCCCCCCC.F[B-](F)(F)F |
| InChI | InChI=1S/C17H37S.BF4/c1-4-6-8-10-12-14-16-18(3)17-15-13-11-9-7-5-2;2-1(3,4)5/h4-17H2,1-3H3;/q+1;-1 |
| InChIKey | PSWPQBONMGNYIK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl(dioctyl)sulfanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(dioctyl)sulfanium tetrafluoroborate?
The IUPAC name of methyl(dioctyl)sulfanium tetrafluoroborate (CID 139757759) is methyl(dioctyl)sulfanium tetrafluoroborate.
What is the SMILES notation for methyl(dioctyl)sulfanium tetrafluoroborate?
The canonical SMILES for methyl(dioctyl)sulfanium tetrafluoroborate is CCCCCCCC[S+](C)CCCCCCCC.F[B-](F)(F)F.
What is the InChIKey of methyl(dioctyl)sulfanium tetrafluoroborate?
The InChIKey is PSWPQBONMGNYIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37S.BF4/c1-4-6-8-10-12-14-16-18(3)17-15-13-11-9-7-5-2;2-1(3,4)5/h4-17H2,1-3H3;/q+1;-1.
What are the key properties of methyl(dioctyl)sulfanium tetrafluoroborate?
methyl(dioctyl)sulfanium tetrafluoroborate has a molecular weight of 360.35 g/mol, XLogP of 7.26, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(dioctyl)sulfanium tetrafluoroborate is sourced from PubChem (CID 139757759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).