C28H40N2O4S2 — CID 139757806
4,5-bis(cyclohexylsulfanyl)-3,6-bis(3-methoxypropoxy)benzene-1,2-dicarbonitrile (PubChem CID 139757806) has the molecular formula C28H40N2O4S2 and a molecular weight of 532.77 g/mol. Its IUPAC name is 4,5-bis(cyclohexylsulfanyl)-3,6-bis(3-methoxypropoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis(cyclohexylsulfanyl)-3,6-bis(3-methoxypropoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139757806 |
| Molecular Formula | C28H40N2O4S2 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 4,5-bis(cyclohexylsulfanyl)-3,6-bis(3-methoxypropoxy)benzene-1,2-dicarbonitrile |
| SMILES | COCCCOc1c(C#N)c(C#N)c(OCCCOC)c(SC2CCCCC2)c1SC1CCCCC1 |
| InChI | InChI=1S/C28H40N2O4S2/c1-31-15-9-17-33-25-23(19-29)24(20-30)26(34-18-10-16-32-2)28(36-22-13-7-4-8-14-22)27(25)35-21-11-5-3-6-12-21/h21-22H,3-18H2,1-2H3 |
| InChIKey | JLEWLYZOOHEWQU-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|