C20H22Cl2N2O4S — CID 139757852
N-[4-[2-[2-(4-acetamidophenyl)-2-chloroethyl]sulfonyl-1-chloroethyl]phenyl]acetamide (PubChem CID 139757852) has the molecular formula C20H22Cl2N2O4S and a molecular weight of 457.38 g/mol. Its IUPAC name is N-[4-[2-[2-(4-acetamidophenyl)-2-chloroethyl]sulfonyl-1-chloroethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[2-(4-acetamidophenyl)-2-chloroethyl]sulfonyl-1-chloroethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139757852 |
| Molecular Formula | C20H22Cl2N2O4S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[4-[2-[2-(4-acetamidophenyl)-2-chloroethyl]sulfonyl-1-chloroethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(Cl)CS(=O)(=O)CC(Cl)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O4S/c1-13(25)23-17-7-3-15(4-8-17)19(21)11-29(27,28)12-20(22)16-5-9-18(10-6-16)24-14(2)26/h3-10,19-20H,11-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | NVJMJFZADZSQPR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|