C24H16F26O — CID 139761694
6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-4-[(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-prop-1-enylnon-2-enoxy)methyl]undeca-2,4-diene (PubChem CID 139761694) has the molecular formula C24H16F26O and a molecular weight of 814.34 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-4-[(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-prop-1-enylnon-2-enoxy)methyl]undeca-2,4-diene.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-4-[(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-prop-1-enylnon-2-enoxy)methyl]undeca-2,4-diene |
|---|---|
| PubChem CID | 139761694 |
| Molecular Formula | C24H16F26O |
| Molecular Weight | 814.34 g/mol |
| Exact Mass | 814.08 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-4-[(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-prop-1-enylnon-2-enoxy)methyl]undeca-2,4-diene |
| SMILES | CC=CC(=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)COCC(C=CC)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H16F26O/c1-3-5-11(7-13(25,26)15(29,30)17(33,34)19(37,38)21(41,42)23(45,46)47)9-51-10-12(6-4-2)8-14(27,28)16(31,32)18(35,36)20(39,40)22(43,44)24(48,49)50/h3-8H,9-10H2,1-2H3 |
| InChIKey | BIWRYBAATHATJF-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.34 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|