C24H38O12 — CID 139763340
[4-(hydroxymethoxy)-3,3-bis[1-(hydroxymethoxy)ethyl]-2,2-bis(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate (PubChem CID 139763340) has the molecular formula C24H38O12 and a molecular weight of 518.56 g/mol. Its IUPAC name is [4-(hydroxymethoxy)-3,3-bis[1-(hydroxymethoxy)ethyl]-2,2-bis(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate.
| Compound Name | [4-(hydroxymethoxy)-3,3-bis[1-(hydroxymethoxy)ethyl]-2,2-bis(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139763340 |
| Molecular Formula | C24H38O12 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | [4-(hydroxymethoxy)-3,3-bis[1-(hydroxymethoxy)ethyl]-2,2-bis(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(OC(=O)C(=C)C)(OC(=O)C(=C)C)C(C(C)OCO)(C(C)OCO)C(C)OCO |
| InChI | InChI=1S/C24H38O12/c1-14(2)20(28)31-10-23(35-21(29)15(3)4,36-22(30)16(5)6)24(17(7)32-11-25,18(8)33-12-26)19(9)34-13-27/h17-19,25-27H,1,3,5,10-13H2,2,4,6-9H3 |
| InChIKey | BOXSJSBLWLECOZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|