C19H22N4OS — CID 139769221
5-(dimethylamino)-N-[3-(methylsulfanyliminomethyl)phenyl]-2,3-dihydroindole-1-carboxamide (PubChem CID 139769221) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[3-(methylsulfanyliminomethyl)phenyl]-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-(dimethylamino)-N-[3-(methylsulfanyliminomethyl)phenyl]-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 139769221 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 5-(dimethylamino)-N-[3-(methylsulfanyliminomethyl)phenyl]-2,3-dihydroindole-1-carboxamide |
| SMILES | CSN=Cc1cccc(NC(=O)N2CCc3cc(N(C)C)ccc32)c1 |
| InChI | InChI=1S/C19H22N4OS/c1-22(2)17-7-8-18-15(12-17)9-10-23(18)19(24)21-16-6-4-5-14(11-16)13-20-25-3/h4-8,11-13H,9-10H2,1-3H3,(H,21,24) |
| InChIKey | CRHNOYLMGGFDNS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|