About magnesium carboxymethylazanide
magnesium carboxymethylazanide (PubChem CID 139769517) has the molecular formula C4H8MgN2O4
and a molecular weight of 172.42 g/mol. Its IUPAC name is magnesium carboxymethylazanide.
Molecular Properties
| Compound Name | magnesium carboxymethylazanide |
| PubChem CID | 139769517 |
| Molecular Formula | C4H8MgN2O4 |
| Molecular Weight | 172.42 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | magnesium carboxymethylazanide |
| SMILES | [Mg+2].[NH-]CC(=O)O.[NH-]CC(=O)O |
| InChI | InChI=1S/2C2H4NO2.Mg/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q2*-1;+2 |
| InChIKey | BCWRIZMSGBOYTL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.42 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze magnesium carboxymethylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium carboxymethylazanide?
The IUPAC name of magnesium carboxymethylazanide (CID 139769517) is magnesium carboxymethylazanide.
What is the SMILES notation for magnesium carboxymethylazanide?
The canonical SMILES for magnesium carboxymethylazanide is [Mg+2].[NH-]CC(=O)O.[NH-]CC(=O)O.
What is the InChIKey of magnesium carboxymethylazanide?
The InChIKey is BCWRIZMSGBOYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H4NO2.Mg/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q2*-1;+2.
What are the key properties of magnesium carboxymethylazanide?
magnesium carboxymethylazanide has a molecular weight of 172.42 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium carboxymethylazanide is sourced from PubChem (CID 139769517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).