About bis(2-azanidylacetate);platinum(4+)
bis(2-azanidylacetate);platinum(4+) (PubChem CID 131873653) has the molecular formula C4H6N2O4Pt
and a molecular weight of 341.18 g/mol. Its IUPAC name is bis(2-azanidylacetate);platinum(4+).
Molecular Properties
| Compound Name | bis(2-azanidylacetate);platinum(4+) |
| PubChem CID | 131873653 |
| Molecular Formula | C4H6N2O4Pt |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | bis(2-azanidylacetate);platinum(4+) |
| SMILES | [NH-]CC(=O)[O-].[NH-]CC(=O)[O-].[Pt+4] |
| InChI | InChI=1S/2C2H4NO2.Pt/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q2*-1;+4/p-2 |
| InChIKey | PUXVNUHFLIAAQY-UHFFFAOYSA-L |
| XLogP | -2.43 |
| TPSA | 127.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-azanidylacetate);platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-azanidylacetate);platinum(4+)?
The IUPAC name of bis(2-azanidylacetate);platinum(4+) (CID 131873653) is bis(2-azanidylacetate);platinum(4+).
What is the SMILES notation for bis(2-azanidylacetate);platinum(4+)?
The canonical SMILES for bis(2-azanidylacetate);platinum(4+) is [NH-]CC(=O)[O-].[NH-]CC(=O)[O-].[Pt+4].
What is the InChIKey of bis(2-azanidylacetate);platinum(4+)?
The InChIKey is PUXVNUHFLIAAQY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H4NO2.Pt/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q2*-1;+4/p-2.
What are the key properties of bis(2-azanidylacetate);platinum(4+)?
bis(2-azanidylacetate);platinum(4+) has a molecular weight of 341.18 g/mol, XLogP of -2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-azanidylacetate);platinum(4+) is sourced from PubChem (CID 131873653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).